About [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane
[(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane (PubChem CID 102149262) has the molecular formula C9H11ClSi
and a molecular weight of 182.73 g/mol. Its IUPAC name is [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane |
| PubChem CID | 102149262 |
| Molecular Formula | C9H11ClSi |
| Molecular Weight | 182.73 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC#C/C=C/Cl |
| InChI | InChI=1S/C9H11ClSi/c1-11(2,3)9-7-5-4-6-8-10/h6,8H,1-3H3/b8-6+ |
| InChIKey | NFUZSNHDTIOYLE-SOFGYWHQSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane?
The IUPAC name of [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane (CID 102149262) is [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane.
What is the SMILES notation for [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane?
The canonical SMILES for [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane is C[Si](C)(C)C#CC#C/C=C/Cl.
What is the InChIKey of [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane?
The InChIKey is NFUZSNHDTIOYLE-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H11ClSi/c1-11(2,3)9-7-5-4-6-8-10/h6,8H,1-3H3/b8-6+.
What are the key properties of [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane?
[(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane has a molecular weight of 182.73 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6-chlorohex-5-en-1,3-diynyl]-trimethylsilane is sourced from PubChem (CID 102149262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).