About 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate (PubChem CID 102150062) has the molecular formula C8H14NO2-
and a molecular weight of 156.20 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate |
| PubChem CID | 102150062 |
| Molecular Formula | C8H14NO2- |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate |
| SMILES | CC1(C)COC(C(C)(C)[O-])=N1 |
| InChI | InChI=1S/C8H14NO2/c1-7(2)5-11-6(9-7)8(3,4)10/h5H2,1-4H3/q-1 |
| InChIKey | GIWYSQOCLVWBMK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate?
The IUPAC name of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate (CID 102150062) is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate.
What is the SMILES notation for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate?
The canonical SMILES for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate is CC1(C)COC(C(C)(C)[O-])=N1.
What is the InChIKey of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate?
The InChIKey is GIWYSQOCLVWBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14NO2/c1-7(2)5-11-6(9-7)8(3,4)10/h5H2,1-4H3/q-1.
What are the key properties of 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate?
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate has a molecular weight of 156.20 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-olate is sourced from PubChem (CID 102150062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).