C22H25N3O3 — CID 102150276
(1S,13R,15S)-8-methoxy-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione (PubChem CID 102150276) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (1S,13R,15S)-8-methoxy-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione.
| Compound Name | (1S,13R,15S)-8-methoxy-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione |
|---|---|
| PubChem CID | 102150276 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (1S,13R,15S)-8-methoxy-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4(9),5,7-tetraene-20,22-dione |
| SMILES | COc1cccc2c3c([nH]c12)C(C)(C)[C@H]1C[C@]24CCCN2C(=O)[C@@]1(C3)NC4=O |
| InChI | InChI=1S/C22H25N3O3/c1-20(2)15-11-21-8-5-9-25(21)19(27)22(15,24-18(21)26)10-13-12-6-4-7-14(28-3)16(12)23-17(13)20/h4,6-7,15,23H,5,8-11H2,1-3H3,(H,24,26)/t15-,21+,22+/m1/s1 |
| InChIKey | KDCRGGYYZBNWRK-YDFBLROQSA-N |
| XLogP | 2.26 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |