C18H21NO8S — CID 102150502
(2R,3R,4S)-3-acetamido-4-(3-thiophen-2-ylprop-2-ynoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 102150502) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(3-thiophen-2-ylprop-2-ynoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(3-thiophen-2-ylprop-2-ynoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 102150502 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(3-thiophen-2-ylprop-2-ynoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1OCC#Cc1cccs1 |
| InChI | InChI=1S/C18H21NO8S/c1-10(21)19-15-13(26-6-2-4-11-5-3-7-28-11)8-14(18(24)25)27-17(15)16(23)12(22)9-20/h3,5,7-8,12-13,15-17,20,22-23H,6,9H2,1H3,(H,19,21)(H,24,25)/t12-,13+,15-,16-,17-/m1/s1 |
| InChIKey | YRMXZAZXDUFRKI-IMPMIVQMSA-N |
| XLogP | -0.93 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|