About CID 102150681
CID 102150681 (PubChem CID 102150681) has the molecular formula C17H14O3-
and a molecular weight of 266.30 g/mol.
Molecular Properties
| Compound Name | CID 102150681 |
| PubChem CID | 102150681 |
| Molecular Formula | C17H14O3- |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2c(c([O-])c1[O])C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H15O3/c1-17(2,3)12-8-11-9-6-4-5-7-10(9)14(18)13(11)16(20)15(12)19/h4-8,20H,1-3H3/p-1 |
| InChIKey | KPRGSOYVSJQYAQ-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102150681 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102150681?
The IUPAC name of CID 102150681 (CID 102150681) is not available.
What is the SMILES notation for CID 102150681?
The canonical SMILES for CID 102150681 is CC(C)(C)c1cc2c(c([O-])c1[O])C(=O)c1ccccc1-2.
What is the InChIKey of CID 102150681?
The InChIKey is KPRGSOYVSJQYAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H15O3/c1-17(2,3)12-8-11-9-6-4-5-7-10(9)14(18)13(11)16(20)15(12)19/h4-8,20H,1-3H3/p-1.
What are the key properties of CID 102150681?
CID 102150681 has a molecular weight of 266.30 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102150681 is sourced from PubChem (CID 102150681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).