C15H10BF2N3O2 — CID 102150779
2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 102150779) has the molecular formula C15H10BF2N3O2 and a molecular weight of 313.07 g/mol. Its IUPAC name is 2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 102150779 |
| Molecular Formula | C15H10BF2N3O2 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2,2-difluoro-8-(4-nitrophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | O=[N+]([O-])c1ccc(C2=C3C=CC=[N+]3[B-](F)(F)n3cccc32)cc1 |
| InChI | InChI=1S/C15H10BF2N3O2/c17-16(18)19-9-1-3-13(19)15(14-4-2-10-20(14)16)11-5-7-12(8-6-11)21(22)23/h1-10H |
| InChIKey | FZALDAWLWSEFKC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|