C20H19BF2N2O2 — CID 102150781
4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoic acid (PubChem CID 102150781) has the molecular formula C20H19BF2N2O2 and a molecular weight of 368.19 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoic acid.
| Compound Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoic acid |
|---|---|
| PubChem CID | 102150781 |
| Molecular Formula | C20H19BF2N2O2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzoic acid |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(C(=O)O)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C20H19BF2N2O2/c1-11-9-13(3)24-18(11)17(15-5-7-16(8-6-15)20(26)27)19-12(2)10-14(4)25(19)21(24,22)23/h5-10H,1-4H3,(H,26,27) |
| InChIKey | LSGGIECGYIBGDU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|