C16H13BF2N2 — CID 102150782
2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 102150782) has the molecular formula C16H13BF2N2 and a molecular weight of 282.10 g/mol. Its IUPAC name is 2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 102150782 |
| Molecular Formula | C16H13BF2N2 |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=C3C=CC=[N+]3[B-](F)(F)n3cccc32)cc1 |
| InChI | InChI=1S/C16H13BF2N2/c1-12-6-8-13(9-7-12)16-14-4-2-10-20(14)17(18,19)21-11-3-5-15(16)21/h2-11H,1H3 |
| InChIKey | CHXAFNCSCKQWAN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|