C17H32O3Si — CID 102150888
ethyl (2E,4E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]hexa-2,4-dienoate (PubChem CID 102150888) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is ethyl (2E,4E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 102150888 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethyl (2E,4E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]hexa-2,4-dienoate |
| SMILES | C/C=C/C=C(\CCCO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H32O3Si/c1-8-10-12-15(16(18)19-9-2)13-11-14-20-21(6,7)17(3,4)5/h8,10,12H,9,11,13-14H2,1-7H3/b10-8+,15-12+ |
| InChIKey | QACANYBMVAAGHJ-VBONDNGNSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|