About (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne
(Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne (PubChem CID 102151055) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne.
Molecular Properties
| Compound Name | (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne |
| PubChem CID | 102151055 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne |
| SMILES | CC#CCC(C/C=C\COC)(COC)COC |
| InChI | InChI=1S/C14H24O3/c1-5-6-9-14(12-16-3,13-17-4)10-7-8-11-15-2/h7-8H,9-13H2,1-4H3/b8-7- |
| InChIKey | RZUILXVNKJCFGD-FPLPWBNLSA-N |
| XLogP | 2.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne?
The IUPAC name of (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne (CID 102151055) is (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne.
What is the SMILES notation for (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne?
The canonical SMILES for (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne is CC#CCC(C/C=C\COC)(COC)COC.
What is the InChIKey of (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne?
The InChIKey is RZUILXVNKJCFGD-FPLPWBNLSA-N. The full InChI is InChI=1S/C14H24O3/c1-5-6-9-14(12-16-3,13-17-4)10-7-8-11-15-2/h7-8H,9-13H2,1-4H3/b8-7-.
What are the key properties of (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne?
(Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne has a molecular weight of 240.34 g/mol, XLogP of 2.27, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-methoxy-5,5-bis(methoxymethyl)non-2-en-7-yne is sourced from PubChem (CID 102151055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).