C17H17N5S — CID 10215156
N'-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine (PubChem CID 10215156) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is N'-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine.
| Compound Name | N'-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 10215156 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N'-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
| SMILES | Cc1cnc2c(NCCN)nc3cc(-c4ccccc4)sc3n12 |
| InChI | InChI=1S/C17H17N5S/c1-11-10-20-16-15(19-8-7-18)21-13-9-14(23-17(13)22(11)16)12-5-3-2-4-6-12/h2-6,9-10H,7-8,18H2,1H3,(H,19,21) |
| InChIKey | AAFMUTYTWRBOGE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |