About 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile
1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile (PubChem CID 10215158) has the molecular formula C18H10ClNO3
and a molecular weight of 323.74 g/mol. Its IUPAC name is 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile.
Molecular Properties
| Compound Name | 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile |
| PubChem CID | 10215158 |
| Molecular Formula | C18H10ClNO3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile |
| SMILES | N#Cc1cc2c(c3ccc(O)c(Cl)c13)OCc1cc(O)ccc1-2 |
| InChI | InChI=1S/C18H10ClNO3/c19-17-15(22)4-3-13-16(17)9(7-20)6-14-12-2-1-11(21)5-10(12)8-23-18(13)14/h1-6,21-22H,8H2 |
| InChIKey | FYXKQAXKAAUQQN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The IUPAC name of 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile (CID 10215158) is 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile.
What is the SMILES notation for 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The canonical SMILES for 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile is N#Cc1cc2c(c3ccc(O)c(Cl)c13)OCc1cc(O)ccc1-2.
What is the InChIKey of 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The InChIKey is FYXKQAXKAAUQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10ClNO3/c19-17-15(22)4-3-13-16(17)9(7-20)6-14-12-2-1-11(21)5-10(12)8-23-18(13)14/h1-6,21-22H,8H2.
What are the key properties of 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile has a molecular weight of 323.74 g/mol, XLogP of 4.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,8-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile is sourced from PubChem (CID 10215158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).