C18H20N4S — CID 10215165
N'-[7-(4-methylsulfanylphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10215165) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is N'-[7-(4-methylsulfanylphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-(4-methylsulfanylphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10215165 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N'-[7-(4-methylsulfanylphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | CSc1ccc(-c2cc3ncccc3c(NCCCN)n2)cc1 |
| InChI | InChI=1S/C18H20N4S/c1-23-14-7-5-13(6-8-14)16-12-17-15(4-2-10-20-17)18(22-16)21-11-3-9-19/h2,4-8,10,12H,3,9,11,19H2,1H3,(H,21,22) |
| InChIKey | NSHOVULIECYORC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|