About 1-deuterio-1,2,2-trifluoroethene
1-deuterio-1,2,2-trifluoroethene (PubChem CID 102151651) has the molecular formula C2HF3
and a molecular weight of 83.03 g/mol. Its IUPAC name is 1-deuterio-1,2,2-trifluoroethene.
Molecular Properties
| Compound Name | 1-deuterio-1,2,2-trifluoroethene |
| PubChem CID | 102151651 |
| Molecular Formula | C2HF3 |
| Molecular Weight | 83.03 g/mol |
| Exact Mass | 83.01 |
| IUPAC Name | 1-deuterio-1,2,2-trifluoroethene |
| SMILES | [2H]C(F)=C(F)F |
| InChI | InChI=1S/C2HF3/c3-1-2(4)5/h1H/i1D |
| InChIKey | MIZLGWKEZAPEFJ-MICDWDOJSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.03 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-deuterio-1,2,2-trifluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-1,2,2-trifluoroethene?
The IUPAC name of 1-deuterio-1,2,2-trifluoroethene (CID 102151651) is 1-deuterio-1,2,2-trifluoroethene.
What is the SMILES notation for 1-deuterio-1,2,2-trifluoroethene?
The canonical SMILES for 1-deuterio-1,2,2-trifluoroethene is [2H]C(F)=C(F)F.
What is the InChIKey of 1-deuterio-1,2,2-trifluoroethene?
The InChIKey is MIZLGWKEZAPEFJ-MICDWDOJSA-N. The full InChI is InChI=1S/C2HF3/c3-1-2(4)5/h1H/i1D.
What are the key properties of 1-deuterio-1,2,2-trifluoroethene?
1-deuterio-1,2,2-trifluoroethene has a molecular weight of 83.03 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-1,2,2-trifluoroethene is sourced from PubChem (CID 102151651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).