C23H30O5 — CID 102152189
methyl (1R,4aS,10aR)-6-acetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 102152189) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-6-acetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-6-acetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 102152189 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | methyl (1R,4aS,10aR)-6-acetyloxy-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(OC(C)=O)c(C(C)C)cc3C(=O)C[C@@H]12 |
| InChI | InChI=1S/C23H30O5/c1-13(2)15-10-16-17(11-19(15)28-14(3)24)22(4)8-7-9-23(5,21(26)27-6)20(22)12-18(16)25/h10-11,13,20H,7-9,12H2,1-6H3/t20-,22-,23-/m1/s1 |
| InChIKey | DYWGHWWGHQMUBE-YMPZKCBVSA-N |
| XLogP | 4.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|