C29H32ClF — CID 102152467
2-chloro-1-(4-fluorophenyl)-4-[4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 102152467) has the molecular formula C29H32ClF and a molecular weight of 435.03 g/mol. Its IUPAC name is 2-chloro-1-(4-fluorophenyl)-4-[4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 2-chloro-1-(4-fluorophenyl)-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 102152467 |
| Molecular Formula | C29H32ClF |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-chloro-1-(4-fluorophenyl)-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(F)cc4)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C29H32ClF/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)26-16-19-28(29(30)20-26)25-14-17-27(31)18-15-25/h10-22H,2-9H2,1H3 |
| InChIKey | XOTBNZGHQXODLR-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|