C14H18N6O4 — CID 102153412
(1S,2R,3R,4S,6R)-4,6-diazido-3-[(4-methoxyphenyl)methoxy]cyclohexane-1,2-diol (PubChem CID 102153412) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diazido-3-[(4-methoxyphenyl)methoxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diazido-3-[(4-methoxyphenyl)methoxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 102153412 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diazido-3-[(4-methoxyphenyl)methoxy]cyclohexane-1,2-diol |
| SMILES | COc1ccc(CO[C@H]2[C@H](O)[C@@H](O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H18N6O4/c1-23-9-4-2-8(3-5-9)7-24-14-11(18-20-16)6-10(17-19-15)12(21)13(14)22/h2-5,10-14,21-22H,6-7H2,1H3/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | NQWVFAOTOCFTCF-MBJXGIAVSA-N |
| XLogP | 2.06 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|