C27H45NO4SSi — CID 102153475
(3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethyl-1-[(4R)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-oxazolidin-3-yl]heptan-1-one (PubChem CID 102153475) has the molecular formula C27H45NO4SSi and a molecular weight of 507.81 g/mol. Its IUPAC name is (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethyl-1-[(4R)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-oxazolidin-3-yl]heptan-1-one.
| Compound Name | (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethyl-1-[(4R)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-oxazolidin-3-yl]heptan-1-one |
|---|---|
| PubChem CID | 102153475 |
| Molecular Formula | C27H45NO4SSi |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethyl-1-[(4R)-2-sulfanylidene-4-(2,4,6-trimethylphenyl)-1,3-oxazolidin-3-yl]heptan-1-one |
| SMILES | Cc1cc(C)c([C@@H]2COC(=S)N2C(=O)C[C@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C)c(C)c1 |
| InChI | InChI=1S/C27H45NO4SSi/c1-16(2)25(32-34(10,11)27(7,8)9)20(6)22(29)14-23(30)28-21(15-31-26(28)33)24-18(4)12-17(3)13-19(24)5/h12-13,16,20-22,25,29H,14-15H2,1-11H3/t20-,21-,22-,25-/m0/s1 |
| InChIKey | LDBVWNXARMFUDX-UEOMBKFZSA-N |
| XLogP | 6.23 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|