C19H21NO2 — CID 102153614
6-methoxy-4,4-dimethyl-3a-phenyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole (PubChem CID 102153614) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6-methoxy-4,4-dimethyl-3a-phenyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole.
| Compound Name | 6-methoxy-4,4-dimethyl-3a-phenyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole |
|---|---|
| PubChem CID | 102153614 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-methoxy-4,4-dimethyl-3a-phenyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indole |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(c3ccccc3)OCCN21 |
| InChI | InChI=1S/C19H21NO2/c1-18(2)16-13-15(21-3)9-10-17(16)20-11-12-22-19(18,20)14-7-5-4-6-8-14/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | YAXIMKBCSFILMX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|