C22H31NO6 — CID 102153649
(1S,2S,3S,6R,7S,14S)-7-ethyl-3-methyl-14-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-13-azatricyclo[11.2.1.02,6]hexadecane-4,8,16-trione (PubChem CID 102153649) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (1S,2S,3S,6R,7S,14S)-7-ethyl-3-methyl-14-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-13-azatricyclo[11.2.1.02,6]hexadecane-4,8,16-trione.
| Compound Name | (1S,2S,3S,6R,7S,14S)-7-ethyl-3-methyl-14-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-13-azatricyclo[11.2.1.02,6]hexadecane-4,8,16-trione |
|---|---|
| PubChem CID | 102153649 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (1S,2S,3S,6R,7S,14S)-7-ethyl-3-methyl-14-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-13-azatricyclo[11.2.1.02,6]hexadecane-4,8,16-trione |
| SMILES | CC[C@@H]1C(=O)CCCCN2C(=O)[C@@H](C[C@H]2[C@@H]2C[C@H](C)C(=O)O2)[C@@H]2[C@H]1OC(=O)[C@H]2C |
| InChI | InChI=1S/C22H31NO6/c1-4-13-16(24)7-5-6-8-23-15(17-9-11(2)21(26)28-17)10-14(20(23)25)18-12(3)22(27)29-19(13)18/h11-15,17-19H,4-10H2,1-3H3/t11-,12-,13+,14-,15-,17-,18+,19-/m0/s1 |
| InChIKey | ZJENACWUVXKSHY-FHDCPALDSA-N |
| XLogP | 2.11 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |