About 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline
3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline (PubChem CID 102154242) has the molecular formula C24H23NO4S2
and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline |
| PubChem CID | 102154242 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline |
| SMILES | Cc1ccc(S(=O)(=O)CC2Nc3ccccc3C=C2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO4S2/c1-17-7-11-20(12-8-17)30(26,27)16-23-24(15-19-5-3-4-6-22(19)25-23)31(28,29)21-13-9-18(2)10-14-21/h3-15,23,25H,16H2,1-2H3 |
| InChIKey | DAPQUHUYNICKLV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline?
The IUPAC name of 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline (CID 102154242) is 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline.
What is the SMILES notation for 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline?
The canonical SMILES for 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline is Cc1ccc(S(=O)(=O)CC2Nc3ccccc3C=C2S(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline?
The InChIKey is DAPQUHUYNICKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO4S2/c1-17-7-11-20(12-8-17)30(26,27)16-23-24(15-19-5-3-4-6-22(19)25-23)31(28,29)21-13-9-18(2)10-14-21/h3-15,23,25H,16H2,1-2H3.
What are the key properties of 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline?
3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline has a molecular weight of 453.59 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]-1,2-dihydroquinoline is sourced from PubChem (CID 102154242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).