C33H38O11 — CID 102154463
4-[[3-butanoyl-2,4,6-trihydroxy-5-[(4-hydroxy-2-methoxy-5-propanoylphenyl)methyl]phenyl]methyl]-3,5-dihydroxy-6,6-dimethyl-2-propanoylcyclohexa-2,4-dien-1-one (PubChem CID 102154463) has the molecular formula C33H38O11 and a molecular weight of 610.66 g/mol. Its IUPAC name is 4-[[3-butanoyl-2,4,6-trihydroxy-5-[(4-hydroxy-2-methoxy-5-propanoylphenyl)methyl]phenyl]methyl]-3,5-dihydroxy-6,6-dimethyl-2-propanoylcyclohexa-2,4-dien-1-one.
| Compound Name | 4-[[3-butanoyl-2,4,6-trihydroxy-5-[(4-hydroxy-2-methoxy-5-propanoylphenyl)methyl]phenyl]methyl]-3,5-dihydroxy-6,6-dimethyl-2-propanoylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 102154463 |
| Molecular Formula | C33H38O11 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 4-[[3-butanoyl-2,4,6-trihydroxy-5-[(4-hydroxy-2-methoxy-5-propanoylphenyl)methyl]phenyl]methyl]-3,5-dihydroxy-6,6-dimethyl-2-propanoylcyclohexa-2,4-dien-1-one |
| SMILES | CCCC(=O)c1c(O)c(CC2=C(O)C(C)(C)C(=O)C(C(=O)CC)=C2O)c(O)c(Cc2cc(C(=O)CC)c(O)cc2OC)c1O |
| InChI | InChI=1S/C33H38O11/c1-7-10-22(36)25-28(39)17(12-15-11-16(20(34)8-2)23(37)14-24(15)44-6)27(38)18(29(25)40)13-19-30(41)26(21(35)9-3)32(43)33(4,5)31(19)42/h11,14,37-42H,7-10,12-13H2,1-6H3 |
| InChIKey | BFBQJSUVRPWHMF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|