C26H38N6O4S2 — CID 102154493
(2R,3R)-N-benzylsulfonyl-2-[[(2S)-2-[[4-(diaminomethylideneamino)phenyl]methylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide (PubChem CID 102154493) has the molecular formula C26H38N6O4S2 and a molecular weight of 562.76 g/mol. Its IUPAC name is (2R,3R)-N-benzylsulfonyl-2-[[(2S)-2-[[4-(diaminomethylideneamino)phenyl]methylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide.
| Compound Name | (2R,3R)-N-benzylsulfonyl-2-[[(2S)-2-[[4-(diaminomethylideneamino)phenyl]methylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 102154493 |
| Molecular Formula | C26H38N6O4S2 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | (2R,3R)-N-benzylsulfonyl-2-[[(2S)-2-[[4-(diaminomethylideneamino)phenyl]methylamino]-4-methylsulfanylbutanoyl]amino]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)[C@H](CCSC)NCc1ccc(N=C(N)N)cc1)C(=O)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H38N6O4S2/c1-4-18(2)23(25(34)32-38(35,36)17-20-8-6-5-7-9-20)31-24(33)22(14-15-37-3)29-16-19-10-12-21(13-11-19)30-26(27)28/h5-13,18,22-23,29H,4,14-17H2,1-3H3,(H,31,33)(H,32,34)(H4,27,28,30)/t18-,22+,23-/m1/s1 |
| InChIKey | AQBFCAQCOTUTDY-YFXJRYMSSA-N |
| XLogP | 1.98 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|