About 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol
4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol (PubChem CID 102154722) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
Molecular Properties
| Compound Name | 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| PubChem CID | 102154722 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| SMILES | CS(=O)(=O)N1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C9H15NO3S/c1-14(12,13)10-4-6-2-5-3-7(6)8(10)9(5)11/h5-9,11H,2-4H2,1H3 |
| InChIKey | BVSPPYYZJPYCRU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The IUPAC name of 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol (CID 102154722) is 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
What is the SMILES notation for 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The canonical SMILES for 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol is CS(=O)(=O)N1CC2CC3CC2C1C3O.
What is the InChIKey of 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The InChIKey is BVSPPYYZJPYCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S/c1-14(12,13)10-4-6-2-5-3-7(6)8(10)9(5)11/h5-9,11H,2-4H2,1H3.
What are the key properties of 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol has a molecular weight of 217.29 g/mol, XLogP of -0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-4-azatricyclo[4.2.1.03,7]nonan-2-ol is sourced from PubChem (CID 102154722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).