C27H40O2Si — CID 102155170
(7S,10R,11S)-16-[tert-butyl(dimethyl)silyl]oxy-6,6,10-trimethyltetracyclo[9.7.0.02,7.013,18]octadeca-1,13(18),14,16-tetraen-9-one (PubChem CID 102155170) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (7S,10R,11S)-16-[tert-butyl(dimethyl)silyl]oxy-6,6,10-trimethyltetracyclo[9.7.0.02,7.013,18]octadeca-1,13(18),14,16-tetraen-9-one.
| Compound Name | (7S,10R,11S)-16-[tert-butyl(dimethyl)silyl]oxy-6,6,10-trimethyltetracyclo[9.7.0.02,7.013,18]octadeca-1,13(18),14,16-tetraen-9-one |
|---|---|
| PubChem CID | 102155170 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (7S,10R,11S)-16-[tert-butyl(dimethyl)silyl]oxy-6,6,10-trimethyltetracyclo[9.7.0.02,7.013,18]octadeca-1,13(18),14,16-tetraen-9-one |
| SMILES | C[C@H]1C(=O)C[C@@H]2C(=C3c4cc(O[Si](C)(C)C(C)(C)C)ccc4C[C@H]31)CCCC2(C)C |
| InChI | InChI=1S/C27H40O2Si/c1-17-21-14-18-11-12-19(29-30(7,8)26(2,3)4)15-22(18)25(21)20-10-9-13-27(5,6)23(20)16-24(17)28/h11-12,15,17,21,23H,9-10,13-14,16H2,1-8H3/t17-,21+,23-/m1/s1 |
| InChIKey | CPEOXAJLHLIBBI-FRGLQRNOSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|