C16H24N2O10 — CID 102155585
[(2R,3S,4S,5S)-2,4,5-triacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate (PubChem CID 102155585) has the molecular formula C16H24N2O10 and a molecular weight of 404.37 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2,4,5-triacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S)-2,4,5-triacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 102155585 |
| Molecular Formula | C16H24N2O10 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2R,3S,4S,5S)-2,4,5-triacetyloxy-1,6-bis(methylamino)-1,6-dioxohexan-3-yl] acetate |
| SMILES | CNC(=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)NC |
| InChI | InChI=1S/C16H24N2O10/c1-7(19)25-11(13(15(23)17-5)27-9(3)21)12(26-8(2)20)14(16(24)18-6)28-10(4)22/h11-14H,1-6H3,(H,17,23)(H,18,24)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | QBCDTEDPFRHQJU-XDQVBPFNSA-N |
| XLogP | -1.79 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|