C18H25N3O7 — CID 102155594
[(2R,3S,5R)-3-acetyloxy-5-[5-(butyliminomethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 102155594) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-[5-(butyliminomethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-[5-(butyliminomethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102155594 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-[5-(butyliminomethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCCC/N=C/c1cn([C@H]2C[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H25N3O7/c1-4-5-6-19-8-13-9-21(18(25)20-17(13)24)16-7-14(27-12(3)23)15(28-16)10-26-11(2)22/h8-9,14-16H,4-7,10H2,1-3H3,(H,20,24,25)/b19-8+/t14-,15+,16+/m0/s1 |
| InChIKey | WLNPBYUSKNUEAH-AIOBEDPHSA-N |
| XLogP | 0.54 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|