About 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one
4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one (PubChem CID 102155629) has the molecular formula C23H13BrN2O
and a molecular weight of 413.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one |
| PubChem CID | 102155629 |
| Molecular Formula | C23H13BrN2O |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one |
| SMILES | O=C1c2ccccc2-c2nc(-c3ccccn3)cc(-c3ccc(Br)cc3)c21 |
| InChI | InChI=1S/C23H13BrN2O/c24-15-10-8-14(9-11-15)18-13-20(19-7-3-4-12-25-19)26-22-16-5-1-2-6-17(16)23(27)21(18)22/h1-13H |
| InChIKey | IUPAXDGKQXJBMY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one?
The IUPAC name of 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one (CID 102155629) is 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one.
What is the SMILES notation for 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one?
The canonical SMILES for 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one is O=C1c2ccccc2-c2nc(-c3ccccn3)cc(-c3ccc(Br)cc3)c21.
What is the InChIKey of 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one?
The InChIKey is IUPAXDGKQXJBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13BrN2O/c24-15-10-8-14(9-11-15)18-13-20(19-7-3-4-12-25-19)26-22-16-5-1-2-6-17(16)23(27)21(18)22/h1-13H.
What are the key properties of 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one?
4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one has a molecular weight of 413.27 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2-pyridin-2-ylindeno[1,2-b]pyridin-5-one is sourced from PubChem (CID 102155629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).