C38H55F5O5 — CID 102156209
(3,4,5-trioctoxyphenyl)methyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 102156209) has the molecular formula C38H55F5O5 and a molecular weight of 686.84 g/mol. Its IUPAC name is (3,4,5-trioctoxyphenyl)methyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | (3,4,5-trioctoxyphenyl)methyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 102156209 |
| Molecular Formula | C38H55F5O5 |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.40 |
| IUPAC Name | (3,4,5-trioctoxyphenyl)methyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCCCCCCCOc1cc(COC(=O)c2c(F)c(F)c(F)c(F)c2F)cc(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C38H55F5O5/c1-4-7-10-13-16-19-22-45-29-25-28(27-48-38(44)31-32(39)34(41)36(43)35(42)33(31)40)26-30(46-23-20-17-14-11-8-5-2)37(29)47-24-21-18-15-12-9-6-3/h25-26H,4-24,27H2,1-3H3 |
| InChIKey | IMNZJINPQWMRPJ-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|