C11H10F2O2 — CID 102156316
4,4-difluoro-1-(2-methoxyphenyl)but-3-en-1-one (PubChem CID 102156316) has the molecular formula C11H10F2O2 and a molecular weight of 212.20 g/mol. Its IUPAC name is 4,4-difluoro-1-(2-methoxyphenyl)but-3-en-1-one.
| Compound Name | 4,4-difluoro-1-(2-methoxyphenyl)but-3-en-1-one |
|---|---|
| PubChem CID | 102156316 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4,4-difluoro-1-(2-methoxyphenyl)but-3-en-1-one |
| SMILES | COc1ccccc1C(=O)CC=C(F)F |
| InChI | InChI=1S/C11H10F2O2/c1-15-10-5-3-2-4-8(10)9(14)6-7-11(12)13/h2-5,7H,6H2,1H3 |
| InChIKey | XONWWSZIOSQXBB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |