C24H20N4OS — CID 102156431
7-benzyl-1-(2-phenylethyl)-2-sulfanylidene-3,5-dihydroimidazo[4,5-g]quinoxalin-6-one (PubChem CID 102156431) has the molecular formula C24H20N4OS and a molecular weight of 412.52 g/mol. Its IUPAC name is 7-benzyl-1-(2-phenylethyl)-2-sulfanylidene-3,5-dihydroimidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 7-benzyl-1-(2-phenylethyl)-2-sulfanylidene-3,5-dihydroimidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 102156431 |
| Molecular Formula | C24H20N4OS |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 7-benzyl-1-(2-phenylethyl)-2-sulfanylidene-3,5-dihydroimidazo[4,5-g]quinoxalin-6-one |
| SMILES | O=c1[nH]c2cc3[nH]c(=S)n(CCc4ccccc4)c3cc2nc1Cc1ccccc1 |
| InChI | InChI=1S/C24H20N4OS/c29-23-21(13-17-9-5-2-6-10-17)25-19-15-22-20(14-18(19)26-23)27-24(30)28(22)12-11-16-7-3-1-4-8-16/h1-10,14-15H,11-13H2,(H,26,29)(H,27,30) |
| InChIKey | NJSKORXQTXUDBH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|