About 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate
4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate (PubChem CID 102156433) has the molecular formula C28H56O7Si2
and a molecular weight of 560.92 g/mol. Its IUPAC name is 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
| PubChem CID | 102156433 |
| Molecular Formula | C28H56O7Si2 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
| SMILES | CCCC[C@@](CCC=O)(OC(=O)CCC(=O)OCC)[C@@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H56O7Si2/c1-9-17-21-28(22-18-23-29,34-27(31)20-19-26(30)32-10-2)25(35-37(14-6,15-7)16-8)24-33-36(11-3,12-4)13-5/h23,25H,9-22,24H2,1-8H3/t25-,28+/m1/s1 |
| InChIKey | XPHZHIUUEUHMQI-NAKRPHOHSA-N |
| XLogP | 7.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate?
The IUPAC name of 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate (CID 102156433) is 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate.
What is the SMILES notation for 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate?
The canonical SMILES for 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate is CCCC[C@@](CCC=O)(OC(=O)CCC(=O)OCC)[C@@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC.
What is the InChIKey of 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate?
The InChIKey is XPHZHIUUEUHMQI-NAKRPHOHSA-N. The full InChI is InChI=1S/C28H56O7Si2/c1-9-17-21-28(22-18-23-29,34-27(31)20-19-26(30)32-10-2)25(35-37(14-6,15-7)16-8)24-33-36(11-3,12-4)13-5/h23,25H,9-22,24H2,1-8H3/t25-,28+/m1/s1.
What are the key properties of 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate?
4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate has a molecular weight of 560.92 g/mol, XLogP of 7.19, 23 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(4S)-4-[(1R)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate is sourced from PubChem (CID 102156433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).