About 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one
3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one (PubChem CID 102156638) has the molecular formula C15H12ClNO2
and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one |
| PubChem CID | 102156638 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one |
| SMILES | O=C1Nc2ccccc2OCC1(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H12ClNO2/c16-15(11-6-2-1-3-7-11)10-19-13-9-5-4-8-12(13)17-14(15)18/h1-9H,10H2,(H,17,18) |
| InChIKey | ONXLPUDOHSJMKH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one?
The IUPAC name of 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one (CID 102156638) is 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one.
What is the SMILES notation for 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one?
The canonical SMILES for 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one is O=C1Nc2ccccc2OCC1(Cl)c1ccccc1.
What is the InChIKey of 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one?
The InChIKey is ONXLPUDOHSJMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO2/c16-15(11-6-2-1-3-7-11)10-19-13-9-5-4-8-12(13)17-14(15)18/h1-9H,10H2,(H,17,18).
What are the key properties of 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one?
3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one has a molecular weight of 273.72 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-3-phenyl-2,5-dihydro-1,5-benzoxazepin-4-one is sourced from PubChem (CID 102156638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).