About 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine
6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine (PubChem CID 10215670) has the molecular formula C15H10ClF2N5S
and a molecular weight of 365.80 g/mol. Its IUPAC name is 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine |
| PubChem CID | 10215670 |
| Molecular Formula | C15H10ClF2N5S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(Nc2cc(F)c(Sc3ccncc3)c(F)c2)n1 |
| InChI | InChI=1S/C15H10ClF2N5S/c16-12-7-13(23-15(19)22-12)21-8-5-10(17)14(11(18)6-8)24-9-1-3-20-4-2-9/h1-7H,(H3,19,21,22,23) |
| InChIKey | GNJFSVHCBUYPTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine (CID 10215670) is 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine is Nc1nc(Cl)cc(Nc2cc(F)c(Sc3ccncc3)c(F)c2)n1.
What is the InChIKey of 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine?
The InChIKey is GNJFSVHCBUYPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N5S/c16-12-7-13(23-15(19)22-12)21-8-5-10(17)14(11(18)6-8)24-9-1-3-20-4-2-9/h1-7H,(H3,19,21,22,23).
What are the key properties of 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine?
6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine has a molecular weight of 365.80 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-N-(3,5-difluoro-4-pyridin-4-ylsulfanylphenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 10215670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).