C27H43IO5 — CID 102156928
[(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienyl] 2,2-dimethylpropanoate (PubChem CID 102156928) has the molecular formula C27H43IO5 and a molecular weight of 574.54 g/mol. Its IUPAC name is [(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102156928 |
| Molecular Formula | C27H43IO5 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | [(3R,4E,6E,8E)-10-[(4S,5S,6R)-6-[(Z)-4-iodobut-2-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxydeca-4,6,8-trienyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](/C=C/C=C/C=C/C[C@@H]1OC(C)(C)O[C@@H](/C(C)=C\CI)[C@H]1C)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H43IO5/c1-20(16-18-28)24-21(2)23(32-27(6,7)33-24)15-13-11-9-10-12-14-22(30-8)17-19-31-25(29)26(3,4)5/h9-14,16,21-24H,15,17-19H2,1-8H3/b10-9+,13-11+,14-12+,20-16-/t21-,22-,23-,24-/m0/s1 |
| InChIKey | WNOIYDNXJWDCKQ-UVEPUNFOSA-N |
| XLogP | 6.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|