C15H32NO7P — CID 10215711
2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 10215711) has the molecular formula C15H32NO7P and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate.
| Compound Name | 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 10215711 |
| Molecular Formula | C15H32NO7P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate |
| SMILES | CCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C15H32NO7P/c1-2-3-4-5-6-7-8-9-15(19)16-10-11-22-24(20,21)23-13-14(18)12-17/h14,17-18H,2-13H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | BBOGBOKIDQJVBT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|