2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate

C15H32NO7P — CID 10215711

IUPAC2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate
SMILESCCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)CO
InChIInChI=1S/C15H32NO7P/c1-2-3-4-5-6-7-8-9-15(19)16-10-11-22-24(20,21)23-13-14(18)12-17/h14,17-18H,2-13H2,1H3,(H,16,19)(H,20,21)
InChIKeyBBOGBOKIDQJVBT-UHFFFAOYSA-N
MW369.40 g/mol
LogP1.73
Rot. Bonds16

About 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate

2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 10215711) has the molecular formula C15H32NO7P and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate.

Molecular Properties

Compound Name2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate
PubChem CID10215711
Molecular FormulaC15H32NO7P
Molecular Weight369.40 g/mol
Exact Mass369.19
IUPAC Name2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate
SMILESCCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)CO
InChIInChI=1S/C15H32NO7P/c1-2-3-4-5-6-7-8-9-15(19)16-10-11-22-24(20,21)23-13-14(18)12-17/h14,17-18H,2-13H2,1H3,(H,16,19)(H,20,21)
InChIKeyBBOGBOKIDQJVBT-UHFFFAOYSA-N
XLogP1.73
TPSA125.32 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds16
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.40
LogP ≤ 51.73
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate?
The IUPAC name of 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate (CID 10215711) is 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate.
What is the SMILES notation for 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate?
The canonical SMILES for 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate is CCCCCCCCCC(=O)NCCOP(=O)(O)OCC(O)CO.
What is the InChIKey of 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate?
The InChIKey is BBOGBOKIDQJVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32NO7P/c1-2-3-4-5-6-7-8-9-15(19)16-10-11-22-24(20,21)23-13-14(18)12-17/h14,17-18H,2-13H2,1H3,(H,16,19)(H,20,21).
What are the key properties of 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate?
2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate has a molecular weight of 369.40 g/mol, XLogP of 1.73, 16 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(decanoylamino)ethyl 2,3-dihydroxypropyl hydrogen phosphate is sourced from PubChem (CID 10215711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).