C15H17F2N5O2S — CID 10215714
N-[[1-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]triazol-4-yl]methyl]acetamide (PubChem CID 10215714) has the molecular formula C15H17F2N5O2S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[[1-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]triazol-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10215714 |
| Molecular Formula | C15H17F2N5O2S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[[1-[3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]triazol-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1cn(-c2cc(F)c(N3CCS(=O)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H17F2N5O2S/c1-10(23)18-8-11-9-22(20-19-11)12-6-13(16)15(14(17)7-12)21-2-4-25(24)5-3-21/h6-7,9H,2-5,8H2,1H3,(H,18,23) |
| InChIKey | FEZKRXYKHQZFAI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|