C23H31Cl3N2O4 — CID 102157337
tert-butyl N-[(4S,5S)-4-(5-tert-butyl-2-prop-2-enoxyphenyl)-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-5-yl]carbamate (PubChem CID 102157337) has the molecular formula C23H31Cl3N2O4 and a molecular weight of 505.87 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-4-(5-tert-butyl-2-prop-2-enoxyphenyl)-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-4-(5-tert-butyl-2-prop-2-enoxyphenyl)-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-5-yl]carbamate |
|---|---|
| PubChem CID | 102157337 |
| Molecular Formula | C23H31Cl3N2O4 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | tert-butyl N-[(4S,5S)-4-(5-tert-butyl-2-prop-2-enoxyphenyl)-2-(trichloromethyl)-5,6-dihydro-4H-1,3-oxazin-5-yl]carbamate |
| SMILES | C=CCOc1ccc(C(C)(C)C)cc1[C@@H]1N=C(C(Cl)(Cl)Cl)OC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31Cl3N2O4/c1-8-11-30-17-10-9-14(21(2,3)4)12-15(17)18-16(27-20(29)32-22(5,6)7)13-31-19(28-18)23(24,25)26/h8-10,12,16,18H,1,11,13H2,2-7H3,(H,27,29)/t16-,18+/m1/s1 |
| InChIKey | ANOBLTXQBFGLPD-AEFFLSMTSA-N |
| XLogP | 6.28 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|