C23H38O — CID 102157565
(2R,4S,6S)-3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexan-1-one (PubChem CID 102157565) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (2R,4S,6S)-3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexan-1-one.
| Compound Name | (2R,4S,6S)-3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 102157565 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (2R,4S,6S)-3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexan-1-one |
| SMILES | CC(C)=CC[C@H]1C[C@H](CC=C(C)C)C(C)(C)[C@@H](CC=C(C)C)C1=O |
| InChI | InChI=1S/C23H38O/c1-16(2)9-12-19-15-20(13-10-17(3)4)23(7,8)21(22(19)24)14-11-18(5)6/h9-11,19-21H,12-15H2,1-8H3/t19-,20-,21-/m0/s1 |
| InChIKey | WULSOIANCSMYGB-ACRUOGEOSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|