C19H23NO5 — CID 102157796
dimethyl 2-[[(4S,4aR,7aR)-4-phenyl-4,4a,5,6,7,7a-hexahydrocyclopenta[e]oxazin-3-yl]methyl]propanedioate (PubChem CID 102157796) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is dimethyl 2-[[(4S,4aR,7aR)-4-phenyl-4,4a,5,6,7,7a-hexahydrocyclopenta[e]oxazin-3-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[(4S,4aR,7aR)-4-phenyl-4,4a,5,6,7,7a-hexahydrocyclopenta[e]oxazin-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 102157796 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | dimethyl 2-[[(4S,4aR,7aR)-4-phenyl-4,4a,5,6,7,7a-hexahydrocyclopenta[e]oxazin-3-yl]methyl]propanedioate |
| SMILES | COC(=O)C(CC1=NO[C@@H]2CCC[C@@H]2[C@H]1c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H23NO5/c1-23-18(21)14(19(22)24-2)11-15-17(12-7-4-3-5-8-12)13-9-6-10-16(13)25-20-15/h3-5,7-8,13-14,16-17H,6,9-11H2,1-2H3/t13-,16+,17+/m0/s1 |
| InChIKey | KMDLRMQGZFIKLR-IAOVAPTHSA-N |
| XLogP | 2.68 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|