C20H20N6O2 — CID 10215809
6,7-diethoxy-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinazolin-4-amine (PubChem CID 10215809) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 6,7-diethoxy-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinazolin-4-amine.
| Compound Name | 6,7-diethoxy-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 10215809 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 6,7-diethoxy-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]quinazolin-4-amine |
| SMILES | CCOc1cc2ncnc(Nc3cccc(-c4ncn[nH]4)c3)c2cc1OCC |
| InChI | InChI=1S/C20H20N6O2/c1-3-27-17-9-15-16(10-18(17)28-4-2)21-11-22-20(15)25-14-7-5-6-13(8-14)19-23-12-24-26-19/h5-12H,3-4H2,1-2H3,(H,21,22,25)(H,23,24,26) |
| InChIKey | WGTILZRWWWHQLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |