C17H23NO — CID 102158209
(7aR,10aR)-4-but-3-enyl-10-methylidene-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one (PubChem CID 102158209) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (7aR,10aR)-4-but-3-enyl-10-methylidene-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one.
| Compound Name | (7aR,10aR)-4-but-3-enyl-10-methylidene-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one |
|---|---|
| PubChem CID | 102158209 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (7aR,10aR)-4-but-3-enyl-10-methylidene-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one |
| SMILES | C=CCCN1C(=O)CC[C@]23C(=C)CC[C@H]2CCC=C13 |
| InChI | InChI=1S/C17H23NO/c1-3-4-12-18-15-7-5-6-14-9-8-13(2)17(14,15)11-10-16(18)19/h3,7,14H,1-2,4-6,8-12H2/t14-,17+/m1/s1 |
| InChIKey | QPACQFDUPHXHCD-PBHICJAKSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|