C25H21N3O — CID 10215860
5,6-bis(4-methylphenyl)-N-phenylpyrazine-2-carboxamide (PubChem CID 10215860) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 5,6-bis(4-methylphenyl)-N-phenylpyrazine-2-carboxamide.
| Compound Name | 5,6-bis(4-methylphenyl)-N-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10215860 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 5,6-bis(4-methylphenyl)-N-phenylpyrazine-2-carboxamide |
| SMILES | Cc1ccc(-c2ncc(C(=O)Nc3ccccc3)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O/c1-17-8-12-19(13-9-17)23-24(20-14-10-18(2)11-15-20)28-22(16-26-23)25(29)27-21-6-4-3-5-7-21/h3-16H,1-2H3,(H,27,29) |
| InChIKey | AKCXCZPEESTMSV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |