C18H20O8 — CID 102158861
(3aR,6S,6aR,9aS,10aR,10bS)-6-[(1S)-1-(methoxymethoxy)ethyl]-3a,4,6,6a,9a,10,10a,10b-octahydro-[2]benzofuro[5,6-e][2]benzofuran-1,3,7,9-tetrone (PubChem CID 102158861) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is (3aR,6S,6aR,9aS,10aR,10bS)-6-[(1S)-1-(methoxymethoxy)ethyl]-3a,4,6,6a,9a,10,10a,10b-octahydro-[2]benzofuro[5,6-e][2]benzofuran-1,3,7,9-tetrone.
| Compound Name | (3aR,6S,6aR,9aS,10aR,10bS)-6-[(1S)-1-(methoxymethoxy)ethyl]-3a,4,6,6a,9a,10,10a,10b-octahydro-[2]benzofuro[5,6-e][2]benzofuran-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 102158861 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (3aR,6S,6aR,9aS,10aR,10bS)-6-[(1S)-1-(methoxymethoxy)ethyl]-3a,4,6,6a,9a,10,10a,10b-octahydro-[2]benzofuro[5,6-e][2]benzofuran-1,3,7,9-tetrone |
| SMILES | COCO[C@@H](C)[C@@H]1C2=CC[C@H]3C(=O)OC(=O)[C@H]3[C@H]2C[C@@H]2C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C18H20O8/c1-7(24-6-23-2)12-8-3-4-9-13(17(21)25-15(9)19)10(8)5-11-14(12)18(22)26-16(11)20/h3,7,9-14H,4-6H2,1-2H3/t7-,9+,10-,11-,12+,13+,14-/m0/s1 |
| InChIKey | CWSIQHOPJLMCCP-VCBUAYSJSA-N |
| XLogP | 0.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|