C12H22NO10S3- — CID 102158903
[(Z)-[5,5-dideuterio-5-(trideuteriomethylsulfinyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl(413C)pentylidene]amino] sulfate (PubChem CID 102158903) has the molecular formula C12H22NO10S3- and a molecular weight of 442.53 g/mol. Its IUPAC name is [(Z)-[5,5-dideuterio-5-(trideuteriomethylsulfinyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl(413C)pentylidene]amino] sulfate.
| Compound Name | [(Z)-[5,5-dideuterio-5-(trideuteriomethylsulfinyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl(413C)pentylidene]amino] sulfate |
|---|---|
| PubChem CID | 102158903 |
| Molecular Formula | C12H22NO10S3- |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [(Z)-[5,5-dideuterio-5-(trideuteriomethylsulfinyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl(413C)pentylidene]amino] sulfate |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[13CH2]CC/C(=N/OS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO10S3/c1-25(18)5-3-2-4-8(13-23-26(19,20)21)24-12-11(17)10(16)9(15)7(6-14)22-12/h7,9-12,14-17H,2-6H2,1H3,(H,19,20,21)/p-1/b13-8-/t7-,9-,10+,11-,12+,25?/m1/s1/i1D3,3+1,5D2 |
| InChIKey | GMMLNKINDDUDCF-HDRARRFLSA-M |
| XLogP | -2.14 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|