About ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate
ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate (PubChem CID 10215894) has the molecular formula C25H35NO2
and a molecular weight of 381.56 g/mol. Its IUPAC name is ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate.
Molecular Properties
| Compound Name | ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate |
| PubChem CID | 10215894 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate |
| SMILES | CCOC(=O)CC(CCN(C(C)C)C(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-6-28-24(27)19-25(22-13-9-7-10-14-22,23-15-11-8-12-16-23)17-18-26(20(2)3)21(4)5/h7-16,20-21H,6,17-19H2,1-5H3 |
| InChIKey | ZCTNXUKZNXIJOB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate?
The IUPAC name of ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate (CID 10215894) is ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate.
What is the SMILES notation for ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate?
The canonical SMILES for ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate is CCOC(=O)CC(CCN(C(C)C)C(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate?
The InChIKey is ZCTNXUKZNXIJOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35NO2/c1-6-28-24(27)19-25(22-13-9-7-10-14-22,23-15-11-8-12-16-23)17-18-26(20(2)3)21(4)5/h7-16,20-21H,6,17-19H2,1-5H3.
What are the key properties of ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate?
ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate has a molecular weight of 381.56 g/mol, XLogP of 5.43, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[di(propan-2-yl)amino]-3,3-diphenylpentanoate is sourced from PubChem (CID 10215894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).