About tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane
tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane (PubChem CID 102159098) has the molecular formula C14H26Si2
and a molecular weight of 250.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane |
| PubChem CID | 102159098 |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane |
| SMILES | C=C=C(C#C[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26Si2/c1-10-13(15(5,6)7)11-12-16(8,9)14(2,3)4/h1H2,2-9H3 |
| InChIKey | IDNGGBYECIJFJI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane?
The IUPAC name of tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane (CID 102159098) is tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane.
What is the SMILES notation for tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane?
The canonical SMILES for tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane is C=C=C(C#C[Si](C)(C)C(C)(C)C)[Si](C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane?
The InChIKey is IDNGGBYECIJFJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26Si2/c1-10-13(15(5,6)7)11-12-16(8,9)14(2,3)4/h1H2,2-9H3.
What are the key properties of tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane?
tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane has a molecular weight of 250.53 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-(3-trimethylsilylpenta-3,4-dien-1-ynyl)silane is sourced from PubChem (CID 102159098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).