C15H26O4 — CID 102159220
(7S)-3-ethenyl-1-methyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.2]octane-2,3,5-triol (PubChem CID 102159220) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (7S)-3-ethenyl-1-methyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.2]octane-2,3,5-triol.
| Compound Name | (7S)-3-ethenyl-1-methyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.2]octane-2,3,5-triol |
|---|---|
| PubChem CID | 102159220 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (7S)-3-ethenyl-1-methyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.2]octane-2,3,5-triol |
| SMILES | C=CC1(O)C2C[C@H](OC(C)(C)C)C(C)(CC2O)C1O |
| InChI | InChI=1S/C15H26O4/c1-6-15(18)9-7-11(19-13(2,3)4)14(5,12(15)17)8-10(9)16/h6,9-12,16-18H,1,7-8H2,2-5H3/t9?,10?,11-,12?,14?,15?/m0/s1 |
| InChIKey | PKCAJQVBOZKYNE-WIAVWWLRSA-N |
| XLogP | 1.24 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|