C25H48O7Si — CID 102159253
2-[(3aR,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-(methoxymethoxymethyl)-2,2,4-trimethyl-5-[(2-methylpropan-2-yl)oxy]-3a,5,6,7-tetrahydro-1,3-benzodioxol-4-yl]acetaldehyde (PubChem CID 102159253) has the molecular formula C25H48O7Si and a molecular weight of 488.74 g/mol. Its IUPAC name is 2-[(3aR,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-(methoxymethoxymethyl)-2,2,4-trimethyl-5-[(2-methylpropan-2-yl)oxy]-3a,5,6,7-tetrahydro-1,3-benzodioxol-4-yl]acetaldehyde.
| Compound Name | 2-[(3aR,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-(methoxymethoxymethyl)-2,2,4-trimethyl-5-[(2-methylpropan-2-yl)oxy]-3a,5,6,7-tetrahydro-1,3-benzodioxol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 102159253 |
| Molecular Formula | C25H48O7Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 2-[(3aR,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-7a-(methoxymethoxymethyl)-2,2,4-trimethyl-5-[(2-methylpropan-2-yl)oxy]-3a,5,6,7-tetrahydro-1,3-benzodioxol-4-yl]acetaldehyde |
| SMILES | COCOC[C@@]12OC(C)(C)O[C@@H]1C(C)(CC=O)[C@@H](OC(C)(C)C)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O7Si/c1-21(2,3)29-18-15-19(31-33(11,12)22(4,5)6)25(16-28-17-27-10)20(24(18,9)13-14-26)30-23(7,8)32-25/h14,18-20H,13,15-17H2,1-12H3/t18-,19-,20+,24?,25-/m0/s1 |
| InChIKey | UVPFGHUQKQHOPI-GGMKZVTFSA-N |
| XLogP | 5.07 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|