C22H25NO — CID 102160060
(5S,8R,8aR)-6-benzyl-8-methyl-5-phenyl-2,3,5,7,8,8a-hexahydropyrano[3,2-c]pyridine (PubChem CID 102160060) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is (5S,8R,8aR)-6-benzyl-8-methyl-5-phenyl-2,3,5,7,8,8a-hexahydropyrano[3,2-c]pyridine.
| Compound Name | (5S,8R,8aR)-6-benzyl-8-methyl-5-phenyl-2,3,5,7,8,8a-hexahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 102160060 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (5S,8R,8aR)-6-benzyl-8-methyl-5-phenyl-2,3,5,7,8,8a-hexahydropyrano[3,2-c]pyridine |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](c2ccccc2)C2=CCCO[C@@H]21 |
| InChI | InChI=1S/C22H25NO/c1-17-15-23(16-18-9-4-2-5-10-18)21(19-11-6-3-7-12-19)20-13-8-14-24-22(17)20/h2-7,9-13,17,21-22H,8,14-16H2,1H3/t17-,21+,22-/m1/s1 |
| InChIKey | PIWVQUTXUZOLPE-VOQZNFBZSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|